EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O4R |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 288.339 |
| Monoisotopic Mass (excl. R groups) | 288.13616 |
| SMILES | *C(=O)c1c([O-])c(CC=C(C)C)c(O)c(CC=C(C)C)c1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-acyl-4,6-diprenylphloroglucinol(1−) (CHEBI:134346) is a phenolate anion (CHEBI:50525) |
| 2-acyl-4,6-diprenylphloroglucinol(1−) (CHEBI:134346) is conjugate base of 2-acyl-4,6-diprenylphloroglucinol (CHEBI:136850) |
| Incoming Relation(s) |
| 2-acyl-4,6-diprenylphloroglucinol (CHEBI:136850) is conjugate acid of 2-acyl-4,6-diprenylphloroglucinol(1−) (CHEBI:134346) |
| UniProt Name | Source |
|---|---|
| a 2-acyl-4,6-diprenylphloroglucinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19788 | MetaCyc |