EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18 |
| Net Charge | 0 |
| Average Mass | 138.254 |
| Monoisotopic Mass | 138.14085 |
| SMILES | CC1=CC[C@@H](C(C)C)CC1 |
| InChI | InChI=1S/C10H18/c1-8(2)10-6-4-9(3)5-7-10/h4,8,10H,5-7H2,1-3H3/t10-/m1/s1 |
| InChIKey | FAMJUFMHYAFYNU-SNVBAGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mentha requienii (ncbitaxon:294740) | - | Article (Planta Med., (1968), 16, 48) | |
| Skimmia laureola (ncbitaxon:354518) | - | Article (Planta Med., (1968), 16, 48) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-1-p-menthene (CHEBI:134313) has role plant metabolite (CHEBI:76924) |
| (S)-1-p-menthene (CHEBI:134313) is a 1-methyl-4-(propan-2-yl)cyclohex-1-ene (CHEBI:134312) |
| (S)-1-p-menthene (CHEBI:134313) is enantiomer of (R)-1-p-menthene (CHEBI:134317) |
| Incoming Relation(s) |
| 1-p-menthene (CHEBI:132847) has part (S)-1-p-menthene (CHEBI:134313) |
| (R)-1-p-menthene (CHEBI:134317) is enantiomer of (S)-1-p-menthene (CHEBI:134313) |
| IUPAC Name |
|---|
| (4S)-1-methyl-4-(propan-2-yl)cyclohex-1-ene |
| Synonyms | Source |
|---|---|
| (4S)-1-p-menthene | ChEBI |
| (-)-Carvomenthene | KNApSAcK |
| (S)-(−)-carvomenthene | ChEBI |
| (S)-carvomenthene | ChEBI |
| (-)-p-Mentha-1-ene | KNApSAcK |