EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:134311 - D-altritol
| Formula | C6H14O6 |
| Net Charge | 0 |
| Average Mass | 182.172 |
| Monoisotopic Mass | 182.07904 |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h1222h]/1/ |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6+/m1/s1 |
| InChIKey | FBPFZTCFMRRESA-KAZBKCHUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Notheia (ncbitaxon:97152) | - | PubMed (11557070) | |
| Himanthalia elongata (ncbitaxon:74478) | - | PubMed (11557070) |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-altritol (CHEBI:134311) has role algal metabolite (CHEBI:84735) |
| D-altritol (CHEBI:134311) has role marine metabolite (CHEBI:76507) |
| D-altritol (CHEBI:134311) is a hexitol (CHEBI:24583) |
| D-altritol (CHEBI:134311) is enantiomer of L-altritol (CHEBI:192698) |
| Incoming Relation(s) |
| β-D-Galf-(1→4)-D-Alt-OH (CHEBI:152596) has functional parent D-altritol (CHEBI:134311) |
| L-altritol (CHEBI:192698) is enantiomer of D-altritol (CHEBI:134311) |
| IUPAC Name |
|---|
| (2R,3R,4S,5R)-hexane-1,2,3,4,5,6-hexol |
| Synonyms | Source |
|---|---|
| D-talitol | SUBMITTER |
| Talitol | ChemIDplus |
| Altritol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| D-altritol | UniProt |
| Citations |
|---|