EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:134301 - salvianolic acid B
| Formula | C36H30O16 |
| Net Charge | 0 |
| Average Mass | 718.620 |
| Monoisotopic Mass | 718.15338 |
| SMILES | O=C(/C=C/c1ccc(O)c2c1[C@H](C(=O)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O)[C@@H](c1ccc(O)c(O)c1)O2)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C36H30O16/c37-20-6-1-16(11-24(20)41)13-27(34(45)46)50-29(44)10-5-18-3-9-23(40)33-30(18)31(32(52-33)19-4-8-22(39)26(43)15-19)36(49)51-28(35(47)48)14-17-2-7-21(38)25(42)12-17/h1-12,15,27-28,31-32,37-43H,13-14H2,(H,45,46)(H,47,48)/b10-5+/t27-,28-,31+,32-/m1/s1 |
| InChIKey | SNKFFCBZYFGCQN-VWUOOIFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia miltiorrhiza (ncbitaxon:226208) | - | PubMed (27569393 ) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). osteogenesis regulator Any compound that induces or regulates osteogenesis. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. hepatoprotective agent Any compound that is able to prevent damage to the liver. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. hypoglycemic agent A drug which lowers the blood glucose level. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salvianolic acid B (CHEBI:134301) has role anti-inflammatory agent (CHEBI:67079) |
| salvianolic acid B (CHEBI:134301) has role antidepressant (CHEBI:35469) |
| salvianolic acid B (CHEBI:134301) has role antineoplastic agent (CHEBI:35610) |
| salvianolic acid B (CHEBI:134301) has role antioxidant (CHEBI:22586) |
| salvianolic acid B (CHEBI:134301) has role apoptosis inducer (CHEBI:68495) |
| salvianolic acid B (CHEBI:134301) has role autophagy inhibitor (CHEBI:88230) |
| salvianolic acid B (CHEBI:134301) has role cardioprotective agent (CHEBI:77307) |
| salvianolic acid B (CHEBI:134301) has role hepatoprotective agent (CHEBI:62868) |
| salvianolic acid B (CHEBI:134301) has role hypoglycemic agent (CHEBI:35526) |
| salvianolic acid B (CHEBI:134301) has role neuroprotective agent (CHEBI:63726) |
| salvianolic acid B (CHEBI:134301) has role osteogenesis regulator (CHEBI:63054) |
| salvianolic acid B (CHEBI:134301) has role plant metabolite (CHEBI:76924) |
| salvianolic acid B (CHEBI:134301) is a 1-benzofurans (CHEBI:38830) |
| salvianolic acid B (CHEBI:134301) is a catechols (CHEBI:33566) |
| salvianolic acid B (CHEBI:134301) is a dicarboxylic acid (CHEBI:35692) |
| salvianolic acid B (CHEBI:134301) is a enoate ester (CHEBI:51702) |
| salvianolic acid B (CHEBI:134301) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2R)-2-({(2E)-3-[(2S,3S)-3-{[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]carbonyl}-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-4-yl]prop-2-enoyl}oxy)-3-(3,4-dihydroxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| Danfensuan B | ChEBI |
| Dan Shen Suan B | ChemIDplus |
| Lithospermate B | SUBMITTER |
| Lithospermic acid B | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8182741 | Reaxys |
| CAS:121521-90-2 | ChemIDplus |
| Citations |
|---|