EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H30O16 |
| Net Charge | 0 |
| Average Mass | 718.620 |
| Monoisotopic Mass | 718.15338 |
| SMILES | O=C(/C=C/c1ccc(O)c2c1[C@H](C(=O)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O)[C@@H](c1ccc(O)c(O)c1)O2)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C36H30O16/c37-20-6-1-16(11-24(20)41)13-27(34(45)46)50-29(44)10-5-18-3-9-23(40)33-30(18)31(32(52-33)19-4-8-22(39)26(43)15-19)36(49)51-28(35(47)48)14-17-2-7-21(38)25(42)12-17/h1-12,15,27-28,31-32,37-43H,13-14H2,(H,45,46)(H,47,48)/b10-5+/t27-,28-,31+,32-/m1/s1 |
| InChIKey | SNKFFCBZYFGCQN-VWUOOIFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia miltiorrhiza (ncbitaxon:226208) | - | PubMed (27569393 ) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | osteogenesis regulator Any compound that induces or regulates osteogenesis. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hepatoprotective agent Any compound that is able to prevent damage to the liver. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salvianolic acid B (CHEBI:134301) has role anti-inflammatory agent (CHEBI:67079) |
| salvianolic acid B (CHEBI:134301) has role antidepressant (CHEBI:35469) |
| salvianolic acid B (CHEBI:134301) has role antineoplastic agent (CHEBI:35610) |
| salvianolic acid B (CHEBI:134301) has role antioxidant (CHEBI:22586) |
| salvianolic acid B (CHEBI:134301) has role apoptosis inducer (CHEBI:68495) |
| salvianolic acid B (CHEBI:134301) has role autophagy inhibitor (CHEBI:88230) |
| salvianolic acid B (CHEBI:134301) has role cardioprotective agent (CHEBI:77307) |
| salvianolic acid B (CHEBI:134301) has role hepatoprotective agent (CHEBI:62868) |
| salvianolic acid B (CHEBI:134301) has role hypoglycemic agent (CHEBI:35526) |
| salvianolic acid B (CHEBI:134301) has role neuroprotective agent (CHEBI:63726) |
| salvianolic acid B (CHEBI:134301) has role osteogenesis regulator (CHEBI:63054) |
| salvianolic acid B (CHEBI:134301) has role plant metabolite (CHEBI:76924) |
| salvianolic acid B (CHEBI:134301) is a 1-benzofurans (CHEBI:38830) |
| salvianolic acid B (CHEBI:134301) is a catechols (CHEBI:33566) |
| salvianolic acid B (CHEBI:134301) is a dicarboxylic acid (CHEBI:35692) |
| salvianolic acid B (CHEBI:134301) is a enoate ester (CHEBI:51702) |
| salvianolic acid B (CHEBI:134301) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2R)-2-({(2E)-3-[(2S,3S)-3-{[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]carbonyl}-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-4-yl]prop-2-enoyl}oxy)-3-(3,4-dihydroxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| Danfensuan B | ChEBI |
| Dan Shen Suan B | ChemIDplus |
| Lithospermate B | SUBMITTER |
| Lithospermic acid B | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8182741 | Reaxys |
| CAS:121521-90-2 | ChemIDplus |
| Citations |
|---|