EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO6 |
| Net Charge | 0 |
| Average Mass | 205.166 |
| Monoisotopic Mass | 205.05864 |
| SMILES | N[C@@H](COC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H11NO6/c8-4(7(12)13)3-14-6(11)2-1-5(9)10/h4H,1-3,8H2,(H,9,10)(H,12,13)/t4-/m0/s1 |
| InChIKey | ZAHSBRLHJRVFAU-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.5.1.48 (cystathionine gamma-synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of cystathionine γ-synthase (EC 2.5.1.48). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-succinyl-L-serine (CHEBI:134286) has role EC 2.5.1.48 (cystathionine γ-synthase) inhibitor (CHEBI:137566) |
| O-succinyl-L-serine (CHEBI:134286) is a L-serine derivative (CHEBI:84135) |
| O-succinyl-L-serine (CHEBI:134286) is a amino dicarboxylic acid (CHEBI:36164) |
| O-succinyl-L-serine (CHEBI:134286) is a hemisuccinate (CHEBI:138979) |
| O-succinyl-L-serine (CHEBI:134286) is conjugate acid of O-succinyl-L-serinate(1−) (CHEBI:136856) |
| Incoming Relation(s) |
| O-succinyl-L-serinate(1−) (CHEBI:136856) is conjugate base of O-succinyl-L-serine (CHEBI:134286) |
| IUPAC Name |
|---|
| 4-[(2S)-2-amino-2-carboxyethoxy]-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| O-succinylserine | ChEBI |
| Ser(Suc)OH | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6698489 | Reaxys |
| Citations |
|---|