EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8OS |
| Net Charge | 0 |
| Average Mass | 140.207 |
| Monoisotopic Mass | 140.02959 |
| SMILES | C[S@@+]([O-])c1ccccc1 |
| InChI | InChI=1S/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3/t9-/m1/s1 |
| InChIKey | JXTGICXCHWMCPM-SECBINFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascophyllum nodosum (ncbitaxon:52969) | - | PubMed (11121113) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-methyl phenyl sulfoxide (CHEBI:134282) is a (methylsulfinyl)benzene (CHEBI:134307) |
| (R)-methyl phenyl sulfoxide (CHEBI:134282) is enantiomer of (S)-methyl phenyl sulfoxide (CHEBI:134306) |
| Incoming Relation(s) |
| rac-methyl phenyl sulfoxide (CHEBI:134310) has part (R)-methyl phenyl sulfoxide (CHEBI:134282) |
| (S)-methyl phenyl sulfoxide (CHEBI:134306) is enantiomer of (R)-methyl phenyl sulfoxide (CHEBI:134282) |
| IUPAC Names |
|---|
| (R)-methyl phenyl sulfoxide |
| (R)-(methylsulfinyl)benzene |
| Synonyms | Source |
|---|---|
| (R)-(methylsulphinyl)benzene | ChEBI |
| (R)-MPSO | ChEBI |
| (R)-phenyl methyl sulfoxide | ChEBI |
| (R)-thioanisole S-oxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2554248 | Reaxys |
| Citations |
|---|