EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | NC(=O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,7,10H,(H2,9,11)/t7-/m0/s1 |
| InChIKey | MAGPZHKLEZXLNU-ZETCQYMHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-mandelamide (CHEBI:134268) is a mandelamide (CHEBI:136824) |
| (S)-mandelamide (CHEBI:134268) is enantiomer of (R)-mandelamide (CHEBI:17352) |
| Incoming Relation(s) |
| (R)-mandelamide (CHEBI:17352) is enantiomer of (S)-mandelamide (CHEBI:134268) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-2-phenylacetamide |
| Synonyms | Source |
|---|---|
| (S)-mandelic amide | ChEBI |
| (S)-mandelic acid amide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5251737 | Reaxys |
| Citations |
|---|