EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12I2O4 |
| Net Charge | 0 |
| Average Mass | 510.065 |
| Monoisotopic Mass | 509.88250 |
| SMILES | O=C(O)CCc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 |
| InChI | InChI=1S/C15H12I2O4/c16-12-7-9(1-6-14(19)20)8-13(17)15(12)21-11-4-2-10(18)3-5-11/h2-5,7-8,18H,1,6H2,(H,19,20) |
| InChIKey | WONYMNWUJVKVII-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-diiodothyropropionic acid (CHEBI:134267) is a aromatic ether (CHEBI:35618) |
| 3,5-diiodothyropropionic acid (CHEBI:134267) is a monocarboxylic acid (CHEBI:25384) |
| 3,5-diiodothyropropionic acid (CHEBI:134267) is a organoiodine compound (CHEBI:37142) |
| 3,5-diiodothyropropionic acid (CHEBI:134267) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid |
| Synonyms | Source |
|---|---|
| 3,5-diiodo-4-(4-hydroxyphenoxy)hydrocinnamic acid | SUBMITTER |
| DITPA | ChemIDplus |
| 3,5-Ditpa | ChemIDplus |
| 3,5-diiodothyropropanoic acid | ChEBI |
| 3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propionic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1158-10-7 | ChemIDplus |