EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N5O3R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 230.245 |
| Monoisotopic Mass (excl. R groups) | 230.12531 |
| SMILES | *[C@H](NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (2143188) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-arginyl-L-amino acid (CHEBI:134262) has functional parent L-arginine (CHEBI:16467) |
| L-arginyl-L-amino acid (CHEBI:134262) is a dipeptide (CHEBI:46761) |
| Synonym | Source |
|---|---|
| Arg-Xaa | ChEBI |
| Citations |
|---|