EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O4 |
| Net Charge | 0 |
| Average Mass | 312.450 |
| Monoisotopic Mass | 312.23006 |
| SMILES | CCCCC/C=C\[C@H](/C=C\CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H32O4/c1-2-3-4-8-11-14-17(22-21)15-12-9-6-5-7-10-13-16-18(19)20/h11-12,14-15,17,21H,2-10,13,16H2,1H3,(H,19,20)/b14-11-,15-12-/t17-/m1/s1 |
| InChIKey | PLWDMWAXENHPLY-LILDEJAOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (11R)-11-hydroperoxylinoleic acid (CHEBI:134247) is a linoleic acid hydroperoxide (CHEBI:78013) |
| (11R)-11-hydroperoxylinoleic acid (CHEBI:134247) is conjugate acid of (11R)-11-hydroperoxylinoleate (CHEBI:134248) |
| (11R)-11-hydroperoxylinoleic acid (CHEBI:134247) is enantiomer of (11S)-11-hydroperoxylinoleic acid (CHEBI:15657) |
| Incoming Relation(s) |
| (11R)-11-hydroperoxylinoleate (CHEBI:134248) is conjugate base of (11R)-11-hydroperoxylinoleic acid (CHEBI:134247) |
| (11S)-11-hydroperoxylinoleic acid (CHEBI:15657) is enantiomer of (11R)-11-hydroperoxylinoleic acid (CHEBI:134247) |
| IUPAC Name |
|---|
| (9Z,11R,12Z)-11-hydroperoxyoctadeca-9,12-dienoic acid |
| Synonyms | Source |
|---|---|
| (11R)-hydroperoxy-(9Z,12Z)-octadecadienoic acid | ChEBI |
| (9Z,11R,12Z)-11-hydroperoxyoctadecadienoic acid | ChEBI |
| Citations |
|---|