EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O3 |
| Net Charge | 0 |
| Average Mass | 251.246 |
| Monoisotopic Mass | 251.10184 |
| SMILES | CCC(O)c1nc2c(=O)nc(N)nc2n(C)c1=O |
| InChI | InChI=1S/C10H13N5O3/c1-3-4(16)5-9(18)15(2)7-6(12-5)8(17)14-10(11)13-7/h4,16H,3H2,1-2H3,(H3,11,13,14,17) |
| InChIKey | AZVYLZYXTPBVOS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photinus pyralis (ncbitaxon:7054) | |||
| - | PubMed (28004739) | ||
| - | MetaboLights (MTBLS362) |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-6-(1-hydroxypropyl)-8-methylpteridine-4,7(3H,8H)-dione (CHEBI:134223) has role animal metabolite (CHEBI:75767) |
| 2-amino-6-(1-hydroxypropyl)-8-methylpteridine-4,7(3H,8H)-dione (CHEBI:134223) is a pteridines (CHEBI:26373) |
| 2-amino-6-(1-hydroxypropyl)-8-methylpteridine-4,7(3H,8H)-dione (CHEBI:134223) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 2-amino-6-(1-hydroxypropyl)-8-methylpteridine-4,7(1H,8H)-dione |
| Synonym | Source |
|---|---|
| 6-(1-hydroxypropyl)-8-methylisoxanthopterin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5078506 | Reaxys |
| Citations |
|---|