EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H6N2O3S2 |
| Net Charge | 0 |
| Average Mass | 278.314 |
| Monoisotopic Mass | 277.98198 |
| SMILES | O=C(O)c1csc(-c2nc3ccc(O)cc3s2)n1 |
| InChI | InChI=1S/C11H6N2O3S2/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16/h1-4,14H,(H,15,16) |
| InChIKey | CYCGRDQQIOGCKX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photinus pyralis (ncbitaxon:7054) | |||
| - | PubMed (28004739) | ||
| - | MetaboLights (MTBLS362) |
| Roles Classification |
|---|
| Chemical Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydroluciferin (CHEBI:134221) has role animal metabolite (CHEBI:75767) |
| dehydroluciferin (CHEBI:134221) has role luciferin (CHEBI:25078) |
| dehydroluciferin (CHEBI:134221) is a 1,3-thiazolemonocarboxylic acid (CHEBI:48652) |
| dehydroluciferin (CHEBI:134221) is a benzothiazoles (CHEBI:37947) |
| dehydroluciferin (CHEBI:134221) is a biaryl (CHEBI:64459) |
| dehydroluciferin (CHEBI:134221) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-(6-hydroxy-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxylic acid |
| Synonym | Source |
|---|---|
| 2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 13230825 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:258913 | Reaxys |
| Citations |
|---|