EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26NO4 |
| Net Charge | +1 |
| Average Mass | 344.431 |
| Monoisotopic Mass | 344.18563 |
| SMILES | COc1ccc(C[C@@H]2c3cc(O)c(OC)cc3CC[N+]2(C)C)cc1O |
| InChI | InChI=1S/C20H25NO4/c1-21(2)8-7-14-11-20(25-4)18(23)12-15(14)16(21)9-13-5-6-19(24-3)17(22)10-13/h5-6,10-12,16H,7-9H2,1-4H3,(H-,22,23)/p+1/t16-/m1/s1 |
| InChIKey | ABSDACFLIMOXJY-MRXNPFEDSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-tembetarine (CHEBI:134198) has functional parent (R)-reticuline (CHEBI:17428) |
| (R)-tembetarine (CHEBI:134198) is a tembetarine (CHEBI:136682) |
| (R)-tembetarine (CHEBI:134198) is enantiomer of (S)-tembetarine (CHEBI:134199) |
| Incoming Relation(s) |
| (S)-tembetarine (CHEBI:134199) is enantiomer of (R)-tembetarine (CHEBI:134198) |
| IUPAC Name |
|---|
| (1R)-7-hydroxy-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2,2-dimethyl-1,2,3,4-tetrahydroisoquinolin-2-ium |
| UniProt Name | Source |
|---|---|
| (R)-tembetarine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30448912 | Reaxys |
| Citations |
|---|