EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N4O7P |
| Net Charge | -1 |
| Average Mass | 329.185 |
| Monoisotopic Mass | 329.02926 |
| SMILES | O=c1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)([O-])O[C@H]2[C@H]1O |
| InChI | InChI=1S/C10H11N4O7P/c15-6-7-4(1-19-22(17,18)21-7)20-10(6)14-3-13-5-8(14)11-2-12-9(5)16/h2-4,6-7,10,15H,1H2,(H,17,18)(H,11,12,16)/p-1/t4-,6-,7-,10-/m1/s1 |
| InChIKey | DMJWGQPYNRPLGA-KQYNXXCUSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5'-cyclic IMP(1−) (CHEBI:134197) is a organophosphate oxoanion (CHEBI:58945) |
| 3',5'-cyclic IMP(1−) (CHEBI:134197) is conjugate base of 3',5'-cyclic IMP (CHEBI:27541) |
| Incoming Relation(s) |
| 3',5'-cyclic IMP (CHEBI:27541) is conjugate acid of 3',5'-cyclic IMP(1−) (CHEBI:134197) |
| UniProt Name | Source |
|---|---|
| 3',5'-cyclic IMP | UniProt |
| Citations |
|---|