EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10NO6PS |
| Net Charge | 0 |
| Average Mass | 267.199 |
| Monoisotopic Mass | 266.99664 |
| SMILES | CC1=N[C@@H](C(=O)O)S/C1=C\COP(=O)(O)O |
| InChI | InChI=1S/C7H10NO6PS/c1-4-5(2-3-14-15(11,12)13)16-6(8-4)7(9)10/h2,6H,3H2,1H3,(H,9,10)(H2,11,12,13)/b5-2-/t6-/m1/s1 |
| InChIKey | PQMCQNOVNFNPFJ-HYIMLASBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (21534620) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,5Z)-4-methyl-5-[2-(phosphonooxy)ethylidene]-2,5-dihydro-1,3-thiazole-2-carboxylic acid (CHEBI:134196) has role bacterial metabolite (CHEBI:76969) |
| (2R,5Z)-4-methyl-5-[2-(phosphonooxy)ethylidene]-2,5-dihydro-1,3-thiazole-2-carboxylic acid (CHEBI:134196) is a 2-carboxy-4-methyl-5-[(2-phosphonooxy)ethylidene]-2,5-dihydrothiazole (CHEBI:52564) |
| (2R,5Z)-4-methyl-5-[2-(phosphonooxy)ethylidene]-2,5-dihydro-1,3-thiazole-2-carboxylic acid (CHEBI:134196) is conjugate acid of (R,Z)- 2-carboxylato-4-methyl-5-[(2-phosphonatooxy)ethylidene]-2,5-dihydrothiazole(3−) (CHEBI:62899) |
| Incoming Relation(s) |
| (R,Z)- 2-carboxylato-4-methyl-5-[(2-phosphonatooxy)ethylidene]-2,5-dihydrothiazole(3−) (CHEBI:62899) is conjugate base of (2R,5Z)-4-methyl-5-[2-(phosphonooxy)ethylidene]-2,5-dihydro-1,3-thiazole-2-carboxylic acid (CHEBI:134196) |
| IUPAC Name |
|---|
| (2R,5Z)-4-methyl-5-[2-(phosphonooxy)ethylidene]-2,5-dihydro-1,3-thiazole-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate | ChEBI |
| cThz*-P | MetaCyc |
| (R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| C20246 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19003148 | Reaxys |
| Citations |
|---|