EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O3 |
| Net Charge | 0 |
| Average Mass | 270.413 |
| Monoisotopic Mass | 270.21949 |
| SMILES | [H]C(=O)CCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H30O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h15H,1-14H2,(H,18,19) |
| InChIKey | NKVUEIHJDGURIA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Solanum tuberosum (ncbitaxon:4113) | - | PubMed (16659915) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-oxohexadecanoic acid (CHEBI:134195) has functional parent hexadecanoic acid (CHEBI:15756) |
| 16-oxohexadecanoic acid (CHEBI:134195) has role plant metabolite (CHEBI:76924) |
| 16-oxohexadecanoic acid (CHEBI:134195) is a aldehydic acid (CHEBI:26643) |
| 16-oxohexadecanoic acid (CHEBI:134195) is a long-chain fatty acid (CHEBI:15904) |
| 16-oxohexadecanoic acid (CHEBI:134195) is a ω-oxo fatty acid (CHEBI:76328) |
| 16-oxohexadecanoic acid (CHEBI:134195) is conjugate acid of 16-oxohexadecanoate (CHEBI:144068) |
| Incoming Relation(s) |
| 16-oxohexadecanoate (CHEBI:144068) is conjugate base of 16-oxohexadecanoic acid (CHEBI:134195) |
| IUPAC Name |
|---|
| 16-oxohexadecanoic acid |
| Synonyms | Source |
|---|---|
| 15-formylpentadecanoic acid | ChEBI |
| 16-Oxopalmitate | KEGG COMPOUND |
| 16-oxopalmitic acid | ChEBI |
| Citations |
|---|