EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23BrO |
| Net Charge | 0 |
| Average Mass | 299.252 |
| Monoisotopic Mass | 298.09323 |
| SMILES | CC(=O)[C@@H]1CC[C@]2(C1)C(C)=CC[C@@H](Br)C2(C)C |
| InChI | InChI=1S/C15H23BrO/c1-10-5-6-13(16)14(3,4)15(10)8-7-12(9-15)11(2)17/h5,12-13H,6-9H2,1-4H3/t12-,13-,15+/m1/s1 |
| InChIKey | BLWJAUBTYPWLDO-NFAWXSAZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Laurencia filiformis (ncbitaxon:110462) | - | Article (Polonsky, J. Am. Chem. Soc., 100, (1978), 2575) | |
| Laurencia glandulifera (WORMS:144822) | - | DOI (10.1016/S0040-4020(01)83121-5) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spirolaurenone (CHEBI:134189) has role algal metabolite (CHEBI:84735) |
| spirolaurenone (CHEBI:134189) is a methyl ketone (CHEBI:51867) |
| spirolaurenone (CHEBI:134189) is a olefinic compound (CHEBI:78840) |
| spirolaurenone (CHEBI:134189) is a organobromine compound (CHEBI:37141) |
| spirolaurenone (CHEBI:134189) is a sesquiterpenoid (CHEBI:26658) |
| spirolaurenone (CHEBI:134189) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| 1-[(2R,5S,9R)-9-bromo-6,10,10-trimethylspiro[4.5]dec-6-en-2-yl]ethan-1-one |
| Synonym | Source |
|---|---|
| 1-(9-Bromo-6,10,10-trimethylspiro[4.5]dec-6-en-2-yl)ethanone | ChEBI |