EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H45N3O4S |
| Net Charge | 0 |
| Average Mass | 555.785 |
| Monoisotopic Mass | 555.31308 |
| SMILES | CC(/C=C/C(C)=C/[C@@H]1Cc2nc(cs2)[C@@H](C)C[C@@H](N)CC(=O)O[C@@H](C)C/C(C)=C/C=C\C(=O)O1)=C\CN(C)C |
| InChI | InChI=1S/C31H45N3O4S/c1-21(13-14-34(6)7)11-12-23(3)16-27-19-29-33-28(20-39-29)24(4)17-26(32)18-31(36)37-25(5)15-22(2)9-8-10-30(35)38-27/h8-13,16,20,24-27H,14-15,17-19,32H2,1-7H3/b10-8-,12-11+,21-13+,22-9+,23-16+/t24-,25-,26+,27+/m0/s1 |
| InChIKey | DSPNTLCJTJBXTD-IRNRRZNASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Mycale hentscheli (ncbitaxon:659499) | - | PubMed (24459774) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. eukaryotic initiation factor 4F inhibitor Any compound that inihibits the mammalian protein, eukaryotic initiation factor 4F. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pateamine (CHEBI:134184) has role antineoplastic agent (CHEBI:35610) |
| pateamine (CHEBI:134184) has role antiviral agent (CHEBI:22587) |
| pateamine (CHEBI:134184) has role eukaryotic initiation factor 4F inhibitor (CHEBI:137079) |
| pateamine (CHEBI:134184) has role marine metabolite (CHEBI:76507) |
| pateamine (CHEBI:134184) is a 1,3-thiazoles (CHEBI:38418) |
| pateamine (CHEBI:134184) is a macrodiolide (CHEBI:145556) |
| pateamine (CHEBI:134184) is a olefinic compound (CHEBI:78840) |
| pateamine (CHEBI:134184) is a primary amino compound (CHEBI:50994) |
| pateamine (CHEBI:134184) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (3S,6Z,8E,11S,15R,17S)-15-amino-3-[(1E,3E,5E)-7-(dimethylamino)-2,5-dimethylhepta-1,3,5-trien-1-yl]-9,11,17-trimethyl-4,12-dioxa-20-thia-21-azabicyclo[16.2.1]henicosa-1(21),6,8,18-tetraene-5,13-dione |
| Synonyms | Source |
|---|---|
| (−)-pateamine | ChEBI |
| Pateamine A | KEGG COMPOUND |
| Citations |
|---|