EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3S |
| Net Charge | 0 |
| Average Mass | 285.416 |
| Monoisotopic Mass | 285.12997 |
| SMILES | CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2 |
| InChI | InChI=1S/C16H19N3S/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13/h5-10,17H,1-4H3 |
| InChIKey | QTWZICCBKBYHDM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Enterococcus faecalis (ncbitaxon:1351) | - | PubMed (16260876) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (16260876) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (15808010) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (15808010) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leucomethylene blue (CHEBI:134180) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| leucomethylene blue (CHEBI:134180) has role fluorochrome (CHEBI:51217) |
| leucomethylene blue (CHEBI:134180) has role mouse metabolite (CHEBI:75771) |
| leucomethylene blue (CHEBI:134180) has role rat metabolite (CHEBI:86264) |
| leucomethylene blue (CHEBI:134180) is a aromatic amine (CHEBI:33860) |
| leucomethylene blue (CHEBI:134180) is a phenothiazines (CHEBI:38093) |
| leucomethylene blue (CHEBI:134180) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N3,N3,N7,N7-tetramethyl-10H-phenothiazine-3,7-diamine |
| Synonyms | Source |
|---|---|
| Panatone | ChemIDplus |
| Reduced methylene blue | KEGG COMPOUND |
| Citations |
|---|