EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H51O4P |
| Net Charge | 0 |
| Average Mass | 506.708 |
| Monoisotopic Mass | 506.35250 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/[C@H]1[C@H](COP(=O)(O)O)[C@@]1(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H51O4P/c1-23(2)13-9-15-25(5)17-11-18-27(7)21-28-29(22-34-35(31,32)33)30(28,8)20-12-19-26(6)16-10-14-24(3)4/h13-14,17,19,21,28-29H,9-12,15-16,18,20,22H2,1-8H3,(H2,31,32,33)/b25-17+,26-19+,27-21+/t28-,29-,30-/m0/s1 |
| InChIKey | GPKFJNOMPPCLGX-VYCBRMPGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| presqualene monophosphate (CHEBI:134117) has functional parent presqualene alcohol (CHEBI:176962) |
| presqualene monophosphate (CHEBI:134117) is a triterpenoid (CHEBI:36615) |
| presqualene monophosphate (CHEBI:134117) is a triterpenyl phosphate (CHEBI:36780) |
| presqualene monophosphate (CHEBI:134117) is conjugate acid of presqualene monophosphate(2−) (CHEBI:176803) |
| Incoming Relation(s) |
| presqualene monophosphate(2−) (CHEBI:176803) is conjugate base of presqualene monophosphate (CHEBI:134117) |
| IUPAC Name |
|---|
| {(1S,2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dien-1-yl]-2-methyl-3-[(2E,6E)-2,6,10-trimethylundeca-1,5,9-trien-1-yl]cyclopropan-1-yl}methyl dihydrogen phosphate |
| Citations |
|---|