EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N5O |
| Net Charge | 0 |
| Average Mass | 151.129 |
| Monoisotopic Mass | 151.04941 |
| SMILES | Nc1ncnc2nc(=O)nc12 |
| InChI | InChI=1S/C5H5N5O/c6-3-2-4(8-1-7-3)10-5(11)9-2/h1H,(H4,6,7,8,9,10,11) |
| InChIKey | RGKBRPAAQSHTED-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (26188111) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxoadenine (CHEBI:134104) has functional parent adenine (CHEBI:16708) |
| 8-oxoadenine (CHEBI:134104) has role human metabolite (CHEBI:77746) |
| 8-oxoadenine (CHEBI:134104) is a 6-aminopurines (CHEBI:20706) |
| 8-oxoadenine (CHEBI:134104) is a nucleobase analogue (CHEBI:67142) |
| 8-oxoadenine (CHEBI:134104) is a oxopurine (CHEBI:25810) |
| 8-oxoadenine (CHEBI:134104) is tautomer of 8-hydroxyadenine (CHEBI:134105) |
| Incoming Relation(s) |
| 8-hydroxyadenine (CHEBI:134105) is tautomer of 8-oxoadenine (CHEBI:134104) |
| IUPAC Name |
|---|
| 6-amino-1,7-dihydro-8H-purin-8-one |
| Synonyms | Source |
|---|---|
| 7,8-Dihydro-8-oxoadenine | ChemIDplus |
| 8-oxo-7,8-dihydroadenine | HMDB |
| 8-oxoA | ChEBI |
| Oxyadenine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00043227 | KNApSAcK |
| HMDB0000542 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:151789 | Reaxys |
| CAS:21149-26-8 | ChemIDplus |
| CAS:21149-26-8 | KNApSAcK |
| Citations |
|---|