EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C6H9O8P)n.H2O |
| Net Charge | -2 |
| Average Mass | 258.119 |
| Monoisotopic Mass | 258.01517 |
| SMILES | [H]O[C@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H2,11,12,13)/p-2/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | NBSCHQHZLSJFNQ-DVKNGEFBSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1→4)-6-phospho-α-D-glucan polyanion (CHEBI:134068) is a organophosphate oxoanion (CHEBI:58945) |
| (1→4)-6-phospho-α-D-glucan polyanion (CHEBI:134068) is a polyanionic polymer (CHEBI:61469) |
| (1→4)-6-phospho-α-D-glucan polyanion (CHEBI:134068) is conjugate base of (1→4)-6-phospho-α-D-glucan (CHEBI:136602) |
| Incoming Relation(s) |
| (1→4)-6-phospho-α-D-glucan (CHEBI:136602) is conjugate acid of (1→4)-6-phospho-α-D-glucan polyanion (CHEBI:134068) |
| UniProt Name | Source |
|---|---|
| (1→4)-6-phospho-α-D-glucan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| (1<arrow>right</arrow>4)-6-phospho-<stereo>alpha</stereo>-<stereo>D</stereo>-glucan | MetaCyc |