EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18Br6 |
| Net Charge | 0 |
| Average Mass | 641.700 |
| Monoisotopic Mass | 635.65087 |
| SMILES | BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br |
| InChI | InChI=1S/C12H18Br6/c13-7-1-2-8(14)10(16)5-6-12(18)11(17)4-3-9(7)15/h7-12H,1-6H2 |
| InChIKey | DEIGXXQKDWULML-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | flame retardant Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,5,6,9,10-hexabromocyclododecane (CHEBI:134063) has role neurotoxin (CHEBI:50910) |
| 1,2,5,6,9,10-hexabromocyclododecane (CHEBI:134063) has role persistent organic pollutant (CHEBI:77853) |
| 1,2,5,6,9,10-hexabromocyclododecane (CHEBI:134063) has role xenobiotic (CHEBI:35703) |
| 1,2,5,6,9,10-hexabromocyclododecane (CHEBI:134063) is a brominated flame retardant (CHEBI:172368) |
| 1,2,5,6,9,10-hexabromocyclododecane (CHEBI:134063) is a bromoalkane (CHEBI:22929) |
| 1,2,5,6,9,10-hexabromocyclododecane (CHEBI:134063) is a bromohydrocarbon (CHEBI:22926) |
| IUPAC Name |
|---|
| 1,2,5,6,9,10-hexabromocyclododecane |
| Synonyms | Source |
|---|---|
| Cyclododecane, 1,2,5,6,9,10-hexabromo- | SUBMITTER |
| HBCD | SUBMITTER |
| Hexabromocyclododecane | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| Hexabromocyclododecane | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1911324 | Reaxys |
| CAS:3194-55-6 | ChemIDplus |
| Citations |
|---|