EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO3 |
| Net Charge | 0 |
| Average Mass | 429.645 |
| Monoisotopic Mass | 429.32429 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-26(29)28-25(27(30)31)23-24-20-17-16-18-21-24/h9-10,16-18,20-21,25H,2-8,11-15,19,22-23H2,1H3,(H,28,29)(H,30,31)/b10-9-/t25-/m0/s1 |
| InChIKey | UWKNPULCJWBBDD-JRUKXMRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoyl-L-phenylalanine (CHEBI:134021) has functional parent oleic acid (CHEBI:16196) |
| N-oleoyl-L-phenylalanine (CHEBI:134021) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| N-oleoyl-L-phenylalanine (CHEBI:134021) is a fatty amide (CHEBI:29348) |
| N-oleoyl-L-phenylalanine (CHEBI:134021) is conjugate acid of N-oleoyl-L-phenylalaninate (CHEBI:134020) |
| Incoming Relation(s) |
| N-oleoyl-L-phenylalaninate (CHEBI:134020) is conjugate base of N-oleoyl-L-phenylalanine (CHEBI:134021) |
| IUPAC Name |
|---|
| N-[(9Z)-octadec-9-enoyl]-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-[(9Z)-octadec-9-enoylamino]-3-phenylpropanoic acid | ChEBI |
| (2S)-2-[(9Z)-octadec-9-enoylamino]-3-phenylpropionic acid | ChEBI |
| N-(9Z-octadecenoyl)-phenylalanine | LIPID MAPS |
| N-oleoyl phenylalanine | LIPID MAPS |
| oleoyl-L-Phe-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020092 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20745810 | Reaxys |
| Citations |
|---|