EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H68O4 |
| Net Charge | 0 |
| Average Mass | 576.947 |
| Monoisotopic Mass | 576.51176 |
| SMILES | CCCCCCCCCCCCCC/C=C\CC[C@@H](O)[C@H](O)CCCCCCCCCCCCC1=C[C@H](C)OC1=O |
| InChI | InChI=1S/C37H68O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-18-21-24-27-30-35(38)36(39)31-28-25-22-19-16-15-17-20-23-26-29-34-32-33(2)41-37(34)40/h21,24,32-33,35-36,38-39H,3-20,22-23,25-31H2,1-2H3/b24-21-/t33-,35+,36+/m0/s1 |
| InChIKey | GPRAXHFBRMJBIJ-GJPJLVQDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona nutans (IPNI:14314-2) | root (BTO:0001188) | PubMed (11000017) | Isolated from the root bark |
| Annona muricata (ncbitaxon:13337) | seed (BTO:0001226) | PubMed (11000017) | |
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS313) | |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS313) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cohibin D (CHEBI:134016) has role mouse metabolite (CHEBI:75771) |
| cohibin D (CHEBI:134016) has role rat metabolite (CHEBI:86264) |
| cohibin D (CHEBI:134016) is a cohibin (CHEBI:134235) |
| IUPAC Name |
|---|
| (5S)-3-[(13RS,14RS,17Z)-13,14-dihydroxydotriacont-17-en-1-yl]-5-methylfuran-2(5H)-one |
| Manual Xrefs | Databases |
|---|---|
| C00047031 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:293735-22-5 | KNApSAcK |
| Citations |
|---|