EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H66O4 |
| Net Charge | 0 |
| Average Mass | 550.909 |
| Monoisotopic Mass | 550.49611 |
| SMILES | CCCCCCCCCCCCC(O)C(O)CCCCCCCCCCCCCCCCC1=CC(C)OC1=O |
| InChI | InChI=1S/C35H66O4/c1-3-4-5-6-7-8-16-19-22-25-28-33(36)34(37)29-26-23-20-17-14-12-10-9-11-13-15-18-21-24-27-32-30-31(2)39-35(32)38/h30-31,33-34,36-37H,3-29H2,1-2H3 |
| InChIKey | NXSNZSWFXOMAOD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS313) | |
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS313) | |
| Annona atemoya (IPNI:1006408-1) | seed (BTO:0001226) | DOI (10.1016/S0031-9422(99)00142-9) |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artemoin B (CHEBI:134013) has role mouse metabolite (CHEBI:75771) |
| artemoin B (CHEBI:134013) has role plant metabolite (CHEBI:76924) |
| artemoin B (CHEBI:134013) has role rat metabolite (CHEBI:86264) |
| artemoin B (CHEBI:134013) is a artemoin (CHEBI:134234) |
| IUPAC Name |
|---|
| 3-(17,18-dihydroxytriacontyl)-5-methylfuran-2(5H)-one |
| Synonyms | Source |
|---|---|
| 3-(17,18-dihydroxytriacontyl)-5-methyl-2,5-dihydrofuran-2-one | HMDB |
| 3-(17,18-Dihydroxytriacontyl)-5-methyl-2(5H)-furanone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033605 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8301349 | Reaxys |