EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18NO3 |
| Net Charge | +1 |
| Average Mass | 260.313 |
| Monoisotopic Mass | 260.12812 |
| SMILES | Oc1ccc(CC[NH2+]Cc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C15H17NO3/c17-13-4-1-11(2-5-13)7-8-16-10-12-3-6-14(18)15(19)9-12/h1-6,9,16-19H,7-8,10H2/p+1 |
| InChIKey | YJYUDTAJVLORNV-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norbelladine(1+) (CHEBI:134001) is a ammonium ion derivative (CHEBI:35274) |
| norbelladine(1+) (CHEBI:134001) is a organic cation (CHEBI:25697) |
| norbelladine(1+) (CHEBI:134001) is conjugate acid of norbelladine (CHEBI:80666) |
| Incoming Relation(s) |
| norbelladine (CHEBI:80666) is conjugate base of norbelladine(1+) (CHEBI:134001) |
| IUPAC Name |
|---|
| N-[(3,4-dihydroxyphenyl)methyl]-2-(4-hydroxyphenyl)ethan-1-aminium |
| UniProt Name | Source |
|---|---|
| norbelladine | UniProt |
| Citations |
|---|