EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11ClF2N2O2 |
| Net Charge | 0 |
| Average Mass | 288.681 |
| Monoisotopic Mass | 288.04771 |
| SMILES | O=C1C=C(N(Cc2ccc(Cl)nc2)CC(F)F)CO1 |
| InChI | InChI=1S/C12H11ClF2N2O2/c13-10-2-1-8(4-16-10)5-17(6-11(14)15)9-3-12(18)19-7-9/h1-4,11H,5-7H2 |
| InChIKey | QOIYTRGFOFZNKF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flupyradifurone (CHEBI:133997) has role insecticide (CHEBI:24852) |
| flupyradifurone (CHEBI:133997) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| flupyradifurone (CHEBI:133997) is a butenolide (CHEBI:50523) |
| flupyradifurone (CHEBI:133997) is a enamine (CHEBI:47989) |
| flupyradifurone (CHEBI:133997) is a monochloropyridine (CHEBI:39172) |
| flupyradifurone (CHEBI:133997) is a organofluorine insecticide (CHEBI:38804) |
| flupyradifurone (CHEBI:133997) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-{[(6-chloropyridin-3-yl)methyl](2,2-difluoroethyl)amino}furan-2(5H)-one |
| Synonyms | Source |
|---|---|
| 4-[[(6-chloro-3-pyridinyl)methyl](2,2-difluoroethyl)amino]-2(5H)-furanone | Alan Wood's Pesticides |
| 4-[(6-chloro-3-pyridylmethyl)(2,2-difluoroethyl)amino]furan-2(5H)-one | Alan Wood's Pesticides |
| Flupyradifuron | ChEBI |
| Brand Name | Source |
|---|---|
| Sivanto | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2620 | PPDB |
| flupyradifurone | Alan Wood's Pesticides |
| US2011130288 | Patent |
| WO2011051151 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19518067 | Reaxys |
| CAS:951659-40-8 | Alan Wood's Pesticides |
| CAS:951659-40-8 | ChemIDplus |
| Citations |
|---|