EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11ClF2N2O2 |
| Net Charge | 0 |
| Average Mass | 288.681 |
| Monoisotopic Mass | 288.04771 |
| SMILES | O=C1C=C(N(Cc2ccc(Cl)nc2)CC(F)F)CO1 |
| InChI | InChI=1S/C12H11ClF2N2O2/c13-10-2-1-8(4-16-10)5-17(6-11(14)15)9-3-12(18)19-7-9/h1-4,11H,5-7H2 |
| InChIKey | QOIYTRGFOFZNKF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flupyradifurone (CHEBI:133997) has role insecticide (CHEBI:24852) |
| flupyradifurone (CHEBI:133997) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| flupyradifurone (CHEBI:133997) is a butenolide (CHEBI:50523) |
| flupyradifurone (CHEBI:133997) is a enamine (CHEBI:47989) |
| flupyradifurone (CHEBI:133997) is a monochloropyridine (CHEBI:39172) |
| flupyradifurone (CHEBI:133997) is a organofluorine insecticide (CHEBI:38804) |
| flupyradifurone (CHEBI:133997) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-{[(6-chloropyridin-3-yl)methyl](2,2-difluoroethyl)amino}furan-2(5H)-one |
| Synonyms | Source |
|---|---|
| 4-[[(6-chloro-3-pyridinyl)methyl](2,2-difluoroethyl)amino]-2(5H)-furanone | Alan Wood's Pesticides |
| 4-[(6-chloro-3-pyridylmethyl)(2,2-difluoroethyl)amino]furan-2(5H)-one | Alan Wood's Pesticides |
| Flupyradifuron | ChEBI |
| Brand Name | Source |
|---|---|
| Sivanto | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2620 | PPDB |
| flupyradifurone | Alan Wood's Pesticides |
| US2011130288 | Patent |
| WO2011051151 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19518067 | Reaxys |
| CAS:951659-40-8 | Alan Wood's Pesticides |
| CAS:951659-40-8 | ChemIDplus |
| Citations |
|---|