EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18NO3 |
| Net Charge | +1 |
| Average Mass | 272.324 |
| Monoisotopic Mass | 272.12812 |
| SMILES | [H][C@]12CC(=O)C=C[C@@]13CC[NH+]2Cc1cc(O)c(OC)cc13 |
| InChI | InChI=1S/C16H17NO3/c1-20-14-8-12-10(6-13(14)19)9-17-5-4-16(12)3-2-11(18)7-15(16)17/h2-3,6,8,15,19H,4-5,7,9H2,1H3/p+1/t15-,16-/m0/s1 |
| InChIKey | VEXDOCFQMVMPHJ-HOTGVXAUSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4aS,10bR)-noroxomaritidine(1+) (CHEBI:133995) is a ammonium ion derivative (CHEBI:35274) |
| (4aS,10bR)-noroxomaritidine(1+) (CHEBI:133995) is a organic cation (CHEBI:25697) |
| (4aS,10bR)-noroxomaritidine(1+) (CHEBI:133995) is conjugate acid of (4aS,10bR)-noroxomaritidine (CHEBI:136557) |
| (4aS,10bR)-noroxomaritidine(1+) (CHEBI:133995) is enantiomer of (4aR,10bS)-noroxomaritidine(1+) (CHEBI:133996) |
| Incoming Relation(s) |
| (4aS,10bR)-noroxomaritidine (CHEBI:136557) is conjugate base of (4aS,10bR)-noroxomaritidine(1+) (CHEBI:133995) |
| (4aR,10bS)-noroxomaritidine(1+) (CHEBI:133996) is enantiomer of (4aS,10bR)-noroxomaritidine(1+) (CHEBI:133995) |
| IUPAC Name |
|---|
| (4aS,10bR)-8-hydroxy-9-methoxy-3-oxo-4,4a,5,6-tetrahydro-3H-5,10b-ethanophenanthridin-5-ium |
| UniProt Name | Source |
|---|---|
| (10bR,4aS)-noroxomaritidine | UniProt |
| Citations |
|---|