EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20NO3 |
| Net Charge | +1 |
| Average Mass | 274.340 |
| Monoisotopic Mass | 274.14377 |
| SMILES | COc1ccc(C[NH2+]CCc2ccc(O)cc2)cc1O |
| InChI | InChI=1S/C16H19NO3/c1-20-16-7-4-13(10-15(16)19)11-17-9-8-12-2-5-14(18)6-3-12/h2-7,10,17-19H,8-9,11H2,1H3/p+1 |
| InChIKey | SDLILULALIDNSO-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-methylnorbelladine(1+) (CHEBI:133993) is a ammonium ion derivative (CHEBI:35274) |
| 4'-O-methylnorbelladine(1+) (CHEBI:133993) is a organic cation (CHEBI:25697) |
| 4'-O-methylnorbelladine(1+) (CHEBI:133993) is conjugate acid of 4'-O-methylnorbelladine (CHEBI:80667) |
| Incoming Relation(s) |
| 4'-O-methylnorbelladine (CHEBI:80667) is conjugate base of 4'-O-methylnorbelladine(1+) (CHEBI:133993) |
| IUPAC Name |
|---|
| N-[(3-hydroxy-4-methoxyphenyl)methyl]-2-(4-hydroxyphenyl)ethan-1-aminium |
| UniProt Name | Source |
|---|---|
| 4'-O-methylnorbelladine | UniProt |
| Citations |
|---|