EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31O4 |
| Net Charge | -1 |
| Average Mass | 311.442 |
| Monoisotopic Mass | 311.22278 |
| SMILES | CCCCC[C@H](/C=C/C=C\CCCCCCCC(=O)[O-])OO |
| InChI | InChI=1S/C18H32O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h7,9,12,15,17,21H,2-6,8,10-11,13-14,16H2,1H3,(H,19,20)/p-1/b9-7-,15-12+/t17-/m1/s1 |
| InChIKey | JDSRHVWSAMTSSN-PIHGWCCBSA-M |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13(R)-HPODE(1−) (CHEBI:133985) is a 13-HPODE(1−) (CHEBI:90823) |
| 13(R)-HPODE(1−) (CHEBI:133985) is conjugate base of (13R)-HPODE (CHEBI:39573) |
| 13(R)-HPODE(1−) (CHEBI:133985) is enantiomer of 13(S)-HPODE(1−) (CHEBI:57466) |
| Incoming Relation(s) |
| (13R)-HPODE (CHEBI:39573) is conjugate acid of 13(R)-HPODE(1−) (CHEBI:133985) |
| 13(S)-HPODE(1−) (CHEBI:57466) is enantiomer of 13(R)-HPODE(1−) (CHEBI:133985) |
| IUPAC Name |
|---|
| (9Z,11E,13R)-13-hydroperoxyoctadeca-9,11-dienoate |
| Synonym | Source |
|---|---|
| (9Z,11E,13R)-13-hydroperoxyoctadecadienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (13R)-hydroperoxy-(9Z,11E)-octadecadienoate | UniProt |