EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O7 |
| Net Charge | 0 |
| Average Mass | 426.550 |
| Monoisotopic Mass | 426.26175 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)OC(CO)CO |
| InChI | InChI=1S/C23H38O7/c1-2-3-6-9-17(26)12-13-20-19(21(27)14-22(20)28)10-7-4-5-8-11-23(29)30-18(15-24)16-25/h4,7,12-13,17-21,24-27H,2-3,5-6,8-11,14-16H2,1H3/b7-4-,13-12+/t17-,19+,20+,21-/m0/s1 |
| InChIKey | OCYWGBZEVKVWBQ-PQGWWSFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (12244105) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin D2 2-glyceryl ester (CHEBI:133979) has functional parent prostaglandin D2 (CHEBI:15555) |
| prostaglandin D2 2-glyceryl ester (CHEBI:133979) has role human xenobiotic metabolite (CHEBI:76967) |
| prostaglandin D2 2-glyceryl ester (CHEBI:133979) is a 2-monoglyceride (CHEBI:17389) |
| prostaglandin D2 2-glyceryl ester (CHEBI:133979) is a alicyclic ketone (CHEBI:36132) |
| prostaglandin D2 2-glyceryl ester (CHEBI:133979) is a prostaglandins D (CHEBI:26337) |
| prostaglandin D2 2-glyceryl ester (CHEBI:133979) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| 1,3-dihydroxypropan-2-yl (5Z,13E,15S)-9α,15-dihydroxy-11-oxoprosta-5,13-dien-1-oate |
| Synonym | Source |
|---|---|
| 2-glyceryl (9α,15S)-dihydroxy-11-oxo-(5Z,13E)-icosadienoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 2-glyceryl-prostaglandin D2 | UniProt |
| Citations |
|---|