EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23O5S |
| Net Charge | -1 |
| Average Mass | 375.466 |
| Monoisotopic Mass | 375.12717 |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(C)CC[C@]1([H])c3ccc(OS(=O)(=O)[O-])cc3CC[C@@]21[H] |
| InChI | InChI=1S/C20H24O5S/c1-3-20(21)11-9-18-17-6-4-13-12-14(25-26(22,23)24)5-7-15(13)16(17)8-10-19(18,20)2/h1,5,7,12,16-18,21H,4,6,8-11H2,2H3,(H,22,23,24)/p-1/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | WLGIWVFFGMPRLM-SLHNCBLASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17α-ethynylestradiol 3-sulfate(1−) (CHEBI:133978) is a steroid sulfate oxoanion (CHEBI:59696) |
| 17α-ethynylestradiol 3-sulfate(1−) (CHEBI:133978) is conjugate base of 17α-ethynylestradiol 3-sulfate (CHEBI:136600) |
| Incoming Relation(s) |
| 17α-ethynylestradiol 3-sulfate (CHEBI:136600) is conjugate acid of 17α-ethynylestradiol 3-sulfate(1−) (CHEBI:133978) |
| IUPAC Name |
|---|
| (17α)-17-hydroxy-19-norpregna-1,3,5(10)-trien-20-yn-3-yl sulfate |
| Synonym | Source |
|---|---|
| 17α-ethynylestradiol sulfate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 17α-ethynylestradiol 3-sulfate | UniProt |
| Citations |
|---|