EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O5S.Na |
| Net Charge | 0 |
| Average Mass | 388.401 |
| Monoisotopic Mass | 388.09431 |
| SMILES | *C(=O)[C@@H](NC(=O)[C@H](N)c1ccc(O)cc1)[C@]1([H])N[C@@H](C(=O)[O-])C(C)(C)S1.[Na+] |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium amoxicilloyl group (CHEBI:133976) has role epitope (CHEBI:53000) |
| sodium amoxicilloyl group (CHEBI:133976) is a univalent carboacyl group (CHEBI:27207) |
| IUPAC Name |
|---|
| sodium (2R)-2-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-2-[(2R,4S)-4-carboxylato-5,5-dimethyl-1,3-thiazolidin-2-yl]acetyl |
| Synonyms | Source |
|---|---|
| AXO antigenic determinant | ChEBI |
| AXO determinant | ChEBI |
| AXO group | ChEBI |
| sodium (2R)-2-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-2-[(2R,4S)-4-carboxylato-5,5-dimethyl-1,3-thiazolidin-2-yl]acetyl group | ChEBI |
| Citations |
|---|