EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O7 |
| Net Charge | 0 |
| Average Mass | 230.172 |
| Monoisotopic Mass | 230.04265 |
| SMILES | O=C(O)/C=C(/C=C/C(=O)O)C(O)CC(=O)O |
| InChI | InChI=1S/C9H10O7/c10-6(4-9(15)16)5(3-8(13)14)1-2-7(11)12/h1-3,6,10H,4H2,(H,11,12)(H,13,14)(H,15,16)/b2-1+,5-3- |
| InChIKey | QZBAPOXIHSUTHJ-WFTYEQLWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (26040782) | The conversion rate was increased 3.5 times by using a coculture of Streptomyces coelicolor and Aspergillus niger. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4E)-3-(2-carboxy-1-hydroxyethyl)-2,4-hexadienedioic acid (CHEBI:133973) has role Aspergillus metabolite (CHEBI:76956) |
| (2Z,4E)-3-(2-carboxy-1-hydroxyethyl)-2,4-hexadienedioic acid (CHEBI:133973) is a olefinic compound (CHEBI:78840) |
| (2Z,4E)-3-(2-carboxy-1-hydroxyethyl)-2,4-hexadienedioic acid (CHEBI:133973) is a secondary alcohol (CHEBI:35681) |
| (2Z,4E)-3-(2-carboxy-1-hydroxyethyl)-2,4-hexadienedioic acid (CHEBI:133973) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| (2E,4Z)-4-(carboxymethylene)-5-hydroxyhept-2-enedioic acid |
| Citations |
|---|