EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O6 |
| Net Charge | 0 |
| Average Mass | 226.184 |
| Monoisotopic Mass | 226.04774 |
| SMILES | C=C1OC(=O)C(C(=O)CCC(=O)OC)=C1O |
| InChI | InChI=1S/C10H10O6/c1-5-9(13)8(10(14)16-5)6(11)3-4-7(12)15-2/h13H,1,3-4H2,2H3 |
| InChIKey | FFBWNTWBOGMXHG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (25044953) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agglomerin F (CHEBI:133955) has role Aspergillus metabolite (CHEBI:76956) |
| agglomerin F (CHEBI:133955) is a butenolide (CHEBI:50523) |
| agglomerin F (CHEBI:133955) is a enol (CHEBI:33823) |
| agglomerin F (CHEBI:133955) is a enone (CHEBI:51689) |
| agglomerin F (CHEBI:133955) is a methyl ester (CHEBI:25248) |
| agglomerin F (CHEBI:133955) is a olefinic compound (CHEBI:78840) |
| agglomerin F (CHEBI:133955) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| methyl 4-(4-hydroxy-5-methylidene-2-oxo-2,5-dihydrofuran-3-yl)-4-oxobutanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27079070 | Reaxys |
| Citations |
|---|