EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16Cl2N4O4 |
| Net Charge | 0 |
| Average Mass | 471.300 |
| Monoisotopic Mass | 470.05486 |
| SMILES | [NH2+]=C(C(=O)[O-])C(c1cnc2c(Cl)cccc12)C(C(=[NH2+])C(=O)[O-])c1cnc2c(Cl)cccc12 |
| InChI | InChI=1S/C22H16Cl2N4O4/c23-13-5-1-3-9-11(7-27-19(9)13)15(17(25)21(29)30)16(18(26)22(31)32)12-8-28-20-10(12)4-2-6-14(20)24/h1-8,15-16,25-28H,(H,29,30)(H,31,32) |
| InChIKey | OKDJEEBLFWDDQL-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-bis(7-chloroindol-3-yl)-2,5-diiminiohexanedioate (CHEBI:133929) is a zwitterion (CHEBI:27369) |
| 3,4-bis(7-chloroindol-3-yl)-2,5-diiminiohexanedioate (CHEBI:133929) is tautomer of 3,4-bis(7-chloroindol-3-yl)-2,5-diiminohexanedioic acid (CHEBI:136437) |
| Incoming Relation(s) |
| 3,4-bis(7-chloroindol-3-yl)-2,5-diiminohexanedioic acid (CHEBI:136437) is tautomer of 3,4-bis(7-chloroindol-3-yl)-2,5-diiminiohexanedioate (CHEBI:133929) |
| IUPAC Name |
|---|
| 3,4-bis(7-chloro-1H-indol-3-yl)-2,5-diiminiohexanedioate |
| Synonym | Source |
|---|---|
| 3,4-bis(7-chloroindol-3-yl)-2,5-diiminohexanedioic acid dizwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| 7-chloroindole-3-pyruvate imine dimer | UniProt |
| Citations |
|---|