EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O6 |
| Net Charge | 0 |
| Average Mass | 270.241 |
| Monoisotopic Mass | 270.08519 |
| SMILES | N=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1C(=O)O |
| InChI | InChI=1S/C11H14N2O6/c12-6-1-2-13(3-5(6)11(17)18)10-9(16)8(15)7(4-14)19-10/h1-3,7-10,12,14-16H,4H2,(H,17,18)/t7-,8-,9-,10-/m1/s1 |
| InChIKey | FYEBWHCXONMZDU-ZYUZMQFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clitocybe acromelalga (ncbitaxon:439023) | - | PubMed (11577392) | |
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clitidine (CHEBI:133925) has functional parent D-ribosylnicotinic acid (CHEBI:27748) |
| clitidine (CHEBI:133925) has role fungal metabolite (CHEBI:76946) |
| clitidine (CHEBI:133925) has role toxin (CHEBI:27026) |
| clitidine (CHEBI:133925) is a imine (CHEBI:24783) |
| clitidine (CHEBI:133925) is a pyridine nucleoside (CHEBI:47896) |
| clitidine (CHEBI:133925) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| IUPAC Name |
|---|
| 4-imino-1-β-ribofuranosyl-1,4-dihydro-3-pyridinecarboxylic acid |
| Synonym | Source |
|---|---|
| Chrytidine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:491171 | Reaxys |
| CAS:63592-84-7 | KEGG COMPOUND |
| CAS:63592-84-7 | ChemIDplus |
| Citations |
|---|