EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O6 |
| Net Charge | 0 |
| Average Mass | 262.262 |
| Monoisotopic Mass | 262.11649 |
| SMILES | NCCCC(NC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N2O6/c11-5-1-2-6(9(15)16)12-7(10(17)18)3-4-8(13)14/h6-7,12H,1-5,11H2,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | UXZAXFPFSQRZOZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Helianthus annuus (ncbitaxon:4232) | - | PubMed (16660462) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ornaline (CHEBI:133921) has role plant metabolite (CHEBI:76924) |
| ornaline (CHEBI:133921) is a glutamic acid derivative (CHEBI:24315) |
| ornaline (CHEBI:133921) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| ornaline (CHEBI:133921) is a ornithine derivative (CHEBI:25718) |
| ornaline (CHEBI:133921) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| N-(4-amino-1-carboxybutyl)glutamic acid |
| Synonyms | Source |
|---|---|
| Nopalinic acid | KEGG COMPOUND |
| N2-(1,3-Dicarboxypropyl)ornithine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C01683 | KEGG COMPOUND |
| 3672801 | ChemSpider |
| CPD-15816 | MetaCyc |
| HMDB0029437 | HMDB |
| Citations |
|---|