EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O3S |
| Net Charge | 0 |
| Average Mass | 188.208 |
| Monoisotopic Mass | 188.02556 |
| SMILES | [H][C@]12CS[C@@H](C(=O)O)[C@@]1([H])NC(=O)N2 |
| InChI | InChI=1S/C6H8N2O3S/c9-5(10)4-3-2(1-12-4)7-6(11)8-3/h2-4H,1H2,(H,9,10)(H2,7,8,11)/t2-,3-,4+/m0/s1 |
| InChIKey | ZYTPHRLFUPVWJX-YVZJFKFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetranorbiotin (CHEBI:133909) is a azabicycloalkane (CHEBI:38295) |
| tetranorbiotin (CHEBI:133909) is a monocarboxylic acid (CHEBI:25384) |
| tetranorbiotin (CHEBI:133909) is a thiabicycloalkane (CHEBI:38297) |
| tetranorbiotin (CHEBI:133909) is a thienoimidazole (CHEBI:47029) |
| tetranorbiotin (CHEBI:133909) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| (3aS,4R,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C20385 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:20349-92-2 | ChemIDplus |