EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO6 |
| Net Charge | 0 |
| Average Mass | 229.188 |
| Monoisotopic Mass | 229.05864 |
| SMILES | NC(C/C(C=C=O)=C/C(O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H11NO6/c10-6(8(13)14)3-5(1-2-11)4-7(12)9(15)16/h1,4,6-7,12H,3,10H2,(H,13,14)(H,15,16)/b5-4+ |
| InChIKey | DDPFUGIRVJYBMN-SNAWJCMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-6-amino-2-hydroxy-4-(2-oxovinyl)hept-3-enedioic acid (CHEBI:133908) is a alanine derivative (CHEBI:22278) |
| (Z)-6-amino-2-hydroxy-4-(2-oxovinyl)hept-3-enedioic acid (CHEBI:133908) is a amino dicarboxylic acid (CHEBI:36164) |
| (Z)-6-amino-2-hydroxy-4-(2-oxovinyl)hept-3-enedioic acid (CHEBI:133908) is a ketene (CHEBI:48002) |
| (Z)-6-amino-2-hydroxy-4-(2-oxovinyl)hept-3-enedioic acid (CHEBI:133908) is a oxo dicarboxylic acid (CHEBI:36145) |
| (Z)-6-amino-2-hydroxy-4-(2-oxovinyl)hept-3-enedioic acid (CHEBI:133908) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (3Z)-6-amino-2-hydroxy-4-(2-oxoethenyl)hept-3-enedioic acid |
| Synonym | Source |
|---|---|
| (Z)-2-amino-6-carboxy-6-hydroxy-4-(2-oxovinyl)-4-hexenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 24785246 | ChemSpider |