EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | [H][C@]12CO[C@H](c3ccc4c(c3)OCO4)[C@@]1([H])CO[C@@H]2c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H22O6/c1-22-16-5-3-12(7-18(16)23-2)20-14-9-25-21(15(14)10-24-20)13-4-6-17-19(8-13)27-11-26-17/h3-8,14-15,20-21H,9-11H2,1-2H3/t14-,15-,20+,21+/m0/s1 |
| InChIKey | AWOGQCSIVCQXBT-VUEDXXQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Zanthoxylum armatum (ncbitaxon:67938) | stem (BTO:0001300) | PubMed (24412550) | |
| Teucrium viscidum (ncbitaxon:587682) | whole plant (BTO:0001461) | PubMed (23337296) | |
| Magnolia biondii (ncbitaxon:86725) | |||
| flower bud (BTO:0000470) | PubMed (7779269) | ||
| flower bud (BTO:0000470) | PubMed (17628872) | ||
| Raulinoa echinata (ncbitaxon:1331808) | leaf (BTO:0000713) | PubMed (11704964) | |
| Zanthoxylum rhetsa (ncbitaxon:1640437) | bark (BTO:0001301) | PubMed (27231889) | |
| Geranium thunbergii (ncbitaxon:345239) | whole plant (BTO:0001461) | PubMed (17225459) | |
| Artemisia gorgonum (ncbitaxon:401901) | aerial part (BTO:0001658) | PubMed (21982788) | |
| Aiouea trinervis (ncbitaxon:881587) | leaf (BTO:0000713) | PubMed (24634118) | |
| Aristolochia gigantea (ncbitaxon:12948) | stem (BTO:0001300) | PubMed (21178901) | |
| Sassafras albidum (ncbitaxon:46945) | bark (BTO:0001301) | PubMed (26411017) | |
| Leucophyllum ambiguum (ncbitaxon:1382326) | - | PubMed (12608853) | |
| Zanthoxylum simulans (ncbitaxon:328402) | - | PubMed (26666037) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demethoxyaschantin (CHEBI:133905) has role plant metabolite (CHEBI:76924) |
| demethoxyaschantin (CHEBI:133905) is a benzodioxoles (CHEBI:38298) |
| demethoxyaschantin (CHEBI:133905) is a dimethoxybenzene (CHEBI:51681) |
| demethoxyaschantin (CHEBI:133905) is a furofuran (CHEBI:47790) |
| demethoxyaschantin (CHEBI:133905) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 5-[(1S,3aR,4S,6aR)-4-(3,4-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2H-1,3-benzodioxole |
| Synonyms | Source |
|---|---|
| Kobusin | KNApSAcK |
| (+)-Demethoxyaschantin | KEGG COMPOUND |
| (+)-Spinescin | KNApSAcK |
| Methylpiperitol | KNApSAcK |
| (+)-Kobusin | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27130216 | Reaxys |
| Reaxys:4911656 | Reaxys |
| CAS:36150-23-9 | KEGG COMPOUND |
| CAS:36150-23-9 | ChemIDplus |
| Citations |
|---|