EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O4 |
| Net Charge | 0 |
| Average Mass | 188.223 |
| Monoisotopic Mass | 188.10486 |
| SMILES | OCC[C@@H]1C(CO)=C(CO)C[C@H]1O |
| InChI | InChI=1S/C9H16O4/c10-2-1-7-8(5-12)6(4-11)3-9(7)13/h7,9-13H,1-5H2/t7-,9-/m1/s1 |
| InChIKey | UALKMMWWGMFYEX-VXNVDRBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Eucommia ulmoides (ncbitaxon:4392) | bark (BTO:0001301) | PubMed (26767291) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eucommiol (CHEBI:133889) has role plant metabolite (CHEBI:76924) |
| eucommiol (CHEBI:133889) has role sedative (CHEBI:35717) |
| eucommiol (CHEBI:133889) is a alicyclic compound (CHEBI:33654) |
| eucommiol (CHEBI:133889) is a primary allylic alcohol (CHEBI:134394) |
| eucommiol (CHEBI:133889) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (1R,2R)-2-(2-hydroxyethyl)-3,4-bis(hydroxymethyl)cyclopent-3-en-1-ol |
| Registry Numbers | Sources |
|---|---|
| CAS:55930-44-4 | ChemIDplus |
| CAS:55930-44-4 | KEGG COMPOUND |
| Citations |
|---|