EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O4 |
| Net Charge | 0 |
| Average Mass | 188.183 |
| Monoisotopic Mass | 188.07971 |
| SMILES | NC[C@@]1(O)CC[C@@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C7H12N2O4/c8-3-7(13)2-1-4(5(10)11)9-6(7)12/h4,13H,1-3,8H2,(H,9,12)(H,10,11)/t4-,7-/m0/s1 |
| InChIKey | ROTDGSCRRKYCRZ-FFWSUHOLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Pseudomonas coronafaciens (ncbitaxon:53409) | - | PubMed (1185324) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tabtoxinine-δ-lactam (CHEBI:133888) has functional parent L-pipecolic acid (CHEBI:30913) |
| tabtoxinine-δ-lactam (CHEBI:133888) has role bacterial metabolite (CHEBI:76969) |
| tabtoxinine-δ-lactam (CHEBI:133888) is a N-acyl-L-α-amino acid (CHEBI:48927) |
| tabtoxinine-δ-lactam (CHEBI:133888) is a amino alcohol (CHEBI:22478) |
| tabtoxinine-δ-lactam (CHEBI:133888) is a δ-lactam (CHEBI:77727) |
| Incoming Relation(s) |
| isotabtoxin (CHEBI:134653) has functional parent tabtoxinine-δ-lactam (CHEBI:133888) |
| IUPAC Name |
|---|
| (2S,5S)-5-(aminomethyl)-5-hydroxy-6-oxopiperidine-2-carboxylic acid |
| Synonym | Source |
|---|---|
| tabtoxinine-δ-lactam | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C20920 | KEGG COMPOUND |
| Citations |
|---|