EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133885 - 4-(methoxymethyl)phenol
| Formula | C8H10O2 |
| Net Charge | 0 |
| Average Mass | 138.166 |
| Monoisotopic Mass | 138.06808 |
| SMILES | COCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H10O2/c1-10-6-7-2-4-8(9)5-3-7/h2-5,9H,6H2,1H3 |
| InChIKey | AHXXIALEMINDAW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maclura tricuspidata (ncbitaxon:210328) | - | PubMed (27420919) | Isolated from root bark |
| Gastrodia elata (ncbitaxon:91201) | - | PubMed (25843525) | |
| Gymnadenia conopsea (ncbitaxon:59324) | tuber (BTO:0001400) | PubMed (21322946) | |
| Sicana odorifera (ncbitaxon:386230) | - | PubMed (11312792) | glycosidically bound |
| Cypripedium calcicola (ncbitaxon:1045547) | - | PubMed (CBA:464361) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(methoxymethyl)phenol (CHEBI:133885) has role plant metabolite (CHEBI:76924) |
| 4-(methoxymethyl)phenol (CHEBI:133885) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-(methoxymethyl)phenol |
| Synonyms | Source |
|---|---|
| p-(methoxymethyl)phenol | ChEBI |
| α-methoxy-p-cresol | ChEBI |
| p-hydroxybenzyl methyl ether | ChEBI |
| 4-hydroxybenzyl methyl ether | ChEBI |
| Citations |
|---|