EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O6 |
| Net Charge | 0 |
| Average Mass | 200.146 |
| Monoisotopic Mass | 200.03209 |
| SMILES | O=C(O)/C=C/C(O)=C\C(=O)CC(=O)O |
| InChI | InChI=1S/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-3,9H,4H2,(H,11,12)(H,13,14)/b2-1+,5-3+ |
| InChIKey | XBRPTASPFXQXPJ-NRNIAZNESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4Z)-4-Hydroxy-6-oxo-2,4-octadienedioic acid (CHEBI:133882) is a enol (CHEBI:33823) |
| (2E,4Z)-4-Hydroxy-6-oxo-2,4-octadienedioic acid (CHEBI:133882) is a oxo dicarboxylic acid (CHEBI:36145) |
| Citations |
|---|