EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19N3O7S |
| Net Charge | 0 |
| Average Mass | 349.365 |
| Monoisotopic Mass | 349.09437 |
| SMILES | CC(=O)SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C12H19N3O7S/c1-6(16)23-5-8(11(20)14-4-10(18)19)15-9(17)3-2-7(13)12(21)22/h7-8H,2-5,13H2,1H3,(H,14,20)(H,15,17)(H,18,19)(H,21,22)/t7-,8-/m0/s1 |
| InChIKey | FVRWSIPJNWXCEO-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-acetylglutathione (CHEBI:133876) has role anti-HSV-1 agent (CHEBI:64953) |
| S-acetylglutathione (CHEBI:133876) has role apoptosis inducer (CHEBI:68495) |
| S-acetylglutathione (CHEBI:133876) is a S-acylglutathione (CHEBI:18126) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-acetyl-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| acetylglutathione | ChEBI |
| S-acetyl-glutathione | ChEBI |
| Citations |
|---|