EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N2O5 |
| Net Charge | 0 |
| Average Mass | 260.290 |
| Monoisotopic Mass | 260.13722 |
| SMILES | C/C(=C\C(=O)N(O)CCC[C@H](N)C(=O)O)CCO |
| InChI | InChI=1S/C11H20N2O5/c1-8(4-6-14)7-10(15)13(18)5-2-3-9(12)11(16)17/h7,9,14,18H,2-6,12H2,1H3,(H,16,17)/b8-7+/t9-/m0/s1 |
| InChIKey | WRFIKQWBKYAFNH-FLOXNTQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-anhydromevalonyl-N5-hydroxy-L-ornithine (CHEBI:133871) is a L-ornithine derivative (CHEBI:21368) |
| N5-anhydromevalonyl-N5-hydroxy-L-ornithine (CHEBI:133871) is a homoallylic alcohol (CHEBI:134362) |
| N5-anhydromevalonyl-N5-hydroxy-L-ornithine (CHEBI:133871) is a hydroxamic acid (CHEBI:24650) |
| N5-anhydromevalonyl-N5-hydroxy-L-ornithine (CHEBI:133871) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| N5-hydroxy-N5-[(2E)-5-hydroxy-3-methylpent-2-enoyl]-L-ornithine |
| Synonym | Source |
|---|---|
| N5-anhydromevalonyl-N5-hydroxyornithine | ChEBI |