EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46N7O19P3S |
| Net Charge | 0 |
| Average Mass | 897.684 |
| Monoisotopic Mass | 897.17820 |
| SMILES | CC(O)(CCO)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C27H46N7O19P3S/c1-26(2,21(39)24(40)30-6-4-16(36)29-7-9-57-17(37)10-27(3,41)5-8-35)12-50-56(47,48)53-55(45,46)49-11-15-20(52-54(42,43)44)19(38)25(51-15)34-14-33-18-22(28)31-13-32-23(18)34/h13-15,19-21,25,35,38-39,41H,4-12H2,1-3H3,(H,29,36)(H,30,40)(H,45,46)(H,47,48)(H2,28,31,32)(H2,42,43,44)/t15-,19-,20-,21+,25-,27?/m1/s1 |
| InChIKey | JFMNRCSZAUKVCF-YBAYKBPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (22106303) |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Roles: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mevalonyl-CoA (CHEBI:133868) has functional parent mevalonic acid (CHEBI:25351) |
| mevalonyl-CoA (CHEBI:133868) has role Aspergillus metabolite (CHEBI:76956) |
| mevalonyl-CoA (CHEBI:133868) has role coenzyme (CHEBI:23354) |
| mevalonyl-CoA (CHEBI:133868) is a acyl-CoA (CHEBI:17984) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(3,5-dihydroxy-3-methylpentanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10515447 | Reaxys |
| Citations |
|---|