EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7F2O6P |
| Net Charge | 0 |
| Average Mass | 292.130 |
| Monoisotopic Mass | 291.99483 |
| SMILES | Cc1cc(=O)oc2c(F)c(OP(=O)(O)O)c(F)cc12 |
| InChI | InChI=1S/C10H7F2O6P/c1-4-2-7(13)17-9-5(4)3-6(11)10(8(9)12)18-19(14,15)16/h2-3H,1H3,(H2,14,15,16) |
| InChIKey | DZANYXOTJVLAEE-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,8-difluoro-4-methylumbelliferyl phosphate (CHEBI:133848) has functional parent coumarin (CHEBI:28794) |
| 6,8-difluoro-4-methylumbelliferyl phosphate (CHEBI:133848) is a coumarins (CHEBI:23403) |
| 6,8-difluoro-4-methylumbelliferyl phosphate (CHEBI:133848) is conjugate acid of 6,8-difluoro-4-methylumbelliferyl phosphate (2−) (CHEBI:133849) |
| Incoming Relation(s) |
| 6,8-difluoro-4-methylumbelliferyl phosphate (2−) (CHEBI:133849) is conjugate base of 6,8-difluoro-4-methylumbelliferyl phosphate (CHEBI:133848) |
| Registry Numbers | Sources |
|---|---|
| CAS:214491-43-7 | SUBMITTER |
| Citations |
|---|